C18H18N6O2 — CID 91250817
3-[[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]methyl]benzamide (PubChem CID 91250817) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 3-[[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]methyl]benzamide.
| Compound Name | 3-[[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 91250817 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 3-[[6-(ethylcarbamoylamino)pyrido[2,3-b]pyrazin-3-yl]methyl]benzamide |
| SMILES | CCNC(=O)Nc1ccc2ncc(Cc3cccc(C(N)=O)c3)nc2n1 |
| InChI | InChI=1S/C18H18N6O2/c1-2-20-18(26)24-15-7-6-14-17(23-15)22-13(10-21-14)9-11-4-3-5-12(8-11)16(19)25/h3-8,10H,2,9H2,1H3,(H2,19,25)(H2,20,22,23,24,26) |
| InChIKey | VFFRYBIDADDJJI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 122.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |