C19H22N6O4S — CID 87656985
1-ethyl-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-2-yl]urea (PubChem CID 87656985) has the molecular formula C19H22N6O4S and a molecular weight of 430.49 g/mol. Its IUPAC name is 1-ethyl-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-2-yl]urea.
| Compound Name | 1-ethyl-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-2-yl]urea |
|---|---|
| PubChem CID | 87656985 |
| Molecular Formula | C19H22N6O4S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 1-ethyl-1-sulfanyl-3-[3-(3,4,5-trimethoxyanilino)pyrido[2,3-b]pyrazin-2-yl]urea |
| SMILES | CCN(S)C(=O)Nc1nc2cccnc2nc1Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H22N6O4S/c1-5-25(30)19(26)24-18-17(23-16-12(22-18)7-6-8-20-16)21-11-9-13(27-2)15(29-4)14(10-11)28-3/h6-10,30H,5H2,1-4H3,(H,20,21,23)(H,22,24,26) |
| InChIKey | XQKLKNWOCOXJCL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|