C16H16N4O2 — CID 54613432
N-(3,4-dimethoxyphenyl)-3-methylpyrido[2,3-b]pyrazin-2-amine (PubChem CID 54613432) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-3-methylpyrido[2,3-b]pyrazin-2-amine.
| Compound Name | N-(3,4-dimethoxyphenyl)-3-methylpyrido[2,3-b]pyrazin-2-amine |
|---|---|
| PubChem CID | 54613432 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-3-methylpyrido[2,3-b]pyrazin-2-amine |
| SMILES | COc1ccc(Nc2nc3cccnc3nc2C)cc1OC |
| InChI | InChI=1S/C16H16N4O2/c1-10-15(20-12-5-4-8-17-16(12)18-10)19-11-6-7-13(21-2)14(9-11)22-3/h4-9H,1-3H3,(H,19,20) |
| InChIKey | XLTDODGRNBKSAE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |