C24H23N3O5S — CID 141211321
3-benzylsulfonyl-N-(3,4,5-trimethoxyphenyl)quinoxalin-2-amine (PubChem CID 141211321) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is 3-benzylsulfonyl-N-(3,4,5-trimethoxyphenyl)quinoxalin-2-amine.
| Compound Name | 3-benzylsulfonyl-N-(3,4,5-trimethoxyphenyl)quinoxalin-2-amine |
|---|---|
| PubChem CID | 141211321 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 3-benzylsulfonyl-N-(3,4,5-trimethoxyphenyl)quinoxalin-2-amine |
| SMILES | COc1cc(Nc2nc3ccccc3nc2S(=O)(=O)Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23N3O5S/c1-30-20-13-17(14-21(31-2)22(20)32-3)25-23-24(27-19-12-8-7-11-18(19)26-23)33(28,29)15-16-9-5-4-6-10-16/h4-14H,15H2,1-3H3,(H,25,26) |
| InChIKey | RLRABUJAIWCMDG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |