C23H21N3O4S — CID 141211320
3-benzylsulfonyl-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine (PubChem CID 141211320) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is 3-benzylsulfonyl-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine.
| Compound Name | 3-benzylsulfonyl-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine |
|---|---|
| PubChem CID | 141211320 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 3-benzylsulfonyl-N-(3,5-dimethoxyphenyl)quinoxalin-2-amine |
| SMILES | COc1cc(Nc2nc3ccccc3nc2S(=O)(=O)Cc2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C23H21N3O4S/c1-29-18-12-17(13-19(14-18)30-2)24-22-23(26-21-11-7-6-10-20(21)25-22)31(27,28)15-16-8-4-3-5-9-16/h3-14H,15H2,1-2H3,(H,24,25) |
| InChIKey | MFUORNCSGCIPTE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |