C23H19F3N4O4S — CID 151992282
N-[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]-N-(trifluoromethyl)benzenesulfonamide (PubChem CID 151992282) has the molecular formula C23H19F3N4O4S and a molecular weight of 504.49 g/mol. Its IUPAC name is N-[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]-N-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]-N-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 151992282 |
| Molecular Formula | C23H19F3N4O4S |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | N-[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]-N-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2N(C(F)(F)F)S(=O)(=O)c2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C23H19F3N4O4S/c1-33-16-12-15(13-17(14-16)34-2)27-21-22(29-20-11-7-6-10-19(20)28-21)30(23(24,25)26)35(31,32)18-8-4-3-5-9-18/h3-14H,1-2H3,(H,27,28) |
| InChIKey | UEXWOFSAHUBEES-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|