C23H19F3N4O2S — CID 143628600
2-N-(3,5-dimethoxyphenyl)-3-N-[4-(trifluoromethyl)phenyl]sulfanylquinoxaline-2,3-diamine (PubChem CID 143628600) has the molecular formula C23H19F3N4O2S and a molecular weight of 472.49 g/mol. Its IUPAC name is 2-N-(3,5-dimethoxyphenyl)-3-N-[4-(trifluoromethyl)phenyl]sulfanylquinoxaline-2,3-diamine.
| Compound Name | 2-N-(3,5-dimethoxyphenyl)-3-N-[4-(trifluoromethyl)phenyl]sulfanylquinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 143628600 |
| Molecular Formula | C23H19F3N4O2S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2-N-(3,5-dimethoxyphenyl)-3-N-[4-(trifluoromethyl)phenyl]sulfanylquinoxaline-2,3-diamine |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NSc2ccc(C(F)(F)F)cc2)cc(OC)c1 |
| InChI | InChI=1S/C23H19F3N4O2S/c1-31-16-11-15(12-17(13-16)32-2)27-21-22(29-20-6-4-3-5-19(20)28-21)30-33-18-9-7-14(8-10-18)23(24,25)26/h3-13H,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | IBFFRRNQFIYZOO-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|