C28H32N6O3S — CID 145495869
2-(butylamino)-N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]amino]sulfanylphenyl]acetamide (PubChem CID 145495869) has the molecular formula C28H32N6O3S and a molecular weight of 532.67 g/mol. Its IUPAC name is 2-(butylamino)-N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]amino]sulfanylphenyl]acetamide.
| Compound Name | 2-(butylamino)-N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]amino]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 145495869 |
| Molecular Formula | C28H32N6O3S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 2-(butylamino)-N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]amino]sulfanylphenyl]acetamide |
| SMILES | CCCCNCC(=O)Nc1cccc(SNc2nc3ccccc3nc2Nc2cc(OC)cc(OC)c2)c1 |
| InChI | InChI=1S/C28H32N6O3S/c1-4-5-13-29-18-26(35)30-19-9-8-10-23(16-19)38-34-28-27(32-24-11-6-7-12-25(24)33-28)31-20-14-21(36-2)17-22(15-20)37-3/h6-12,14-17,29H,4-5,13,18H2,1-3H3,(H,30,35)(H,31,32)(H,33,34) |
| InChIKey | HQMCHNJSHJBOMM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|