C27H27N5O4S — CID 143442710
N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]amino]sulfanylphenyl]oxolane-2-carboxamide (PubChem CID 143442710) has the molecular formula C27H27N5O4S and a molecular weight of 517.61 g/mol. Its IUPAC name is N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]amino]sulfanylphenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]amino]sulfanylphenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 143442710 |
| Molecular Formula | C27H27N5O4S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]amino]sulfanylphenyl]oxolane-2-carboxamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NSc2cccc(NC(=O)C3CCCO3)c2)cc(OC)c1 |
| InChI | InChI=1S/C27H27N5O4S/c1-34-19-13-18(14-20(16-19)35-2)28-25-26(31-23-10-4-3-9-22(23)30-25)32-37-21-8-5-7-17(15-21)29-27(33)24-11-6-12-36-24/h3-5,7-10,13-16,24H,6,11-12H2,1-2H3,(H,28,30)(H,29,33)(H,31,32) |
| InChIKey | LVIYJYGLONCZBY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 106.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|