C21H20N6OS — CID 145495859
2-N-(3-amino-5-methoxyphenyl)-3-N-(3-aminophenyl)sulfanylquinoxaline-2,3-diamine (PubChem CID 145495859) has the molecular formula C21H20N6OS and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-N-(3-amino-5-methoxyphenyl)-3-N-(3-aminophenyl)sulfanylquinoxaline-2,3-diamine.
| Compound Name | 2-N-(3-amino-5-methoxyphenyl)-3-N-(3-aminophenyl)sulfanylquinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 145495859 |
| Molecular Formula | C21H20N6OS |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-N-(3-amino-5-methoxyphenyl)-3-N-(3-aminophenyl)sulfanylquinoxaline-2,3-diamine |
| SMILES | COc1cc(N)cc(Nc2nc3ccccc3nc2NSc2cccc(N)c2)c1 |
| InChI | InChI=1S/C21H20N6OS/c1-28-16-10-14(23)9-15(12-16)24-20-21(26-19-8-3-2-7-18(19)25-20)27-29-17-6-4-5-13(22)11-17/h2-12H,22-23H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | DJTHPEJMGQEDHW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|