C15H13FN4O — CID 141168476
3-N-(3-fluoro-5-methoxyphenyl)quinoxaline-2,3-diamine (PubChem CID 141168476) has the molecular formula C15H13FN4O and a molecular weight of 284.29 g/mol. Its IUPAC name is 3-N-(3-fluoro-5-methoxyphenyl)quinoxaline-2,3-diamine.
| Compound Name | 3-N-(3-fluoro-5-methoxyphenyl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 141168476 |
| Molecular Formula | C15H13FN4O |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 3-N-(3-fluoro-5-methoxyphenyl)quinoxaline-2,3-diamine |
| SMILES | COc1cc(F)cc(Nc2nc3ccccc3nc2N)c1 |
| InChI | InChI=1S/C15H13FN4O/c1-21-11-7-9(16)6-10(8-11)18-15-14(17)19-12-4-2-3-5-13(12)20-15/h2-8H,1H3,(H2,17,19)(H,18,20) |
| InChIKey | KERFBMVYXPNNOA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |