C14H11IN4 — CID 102985385
3-N-(3-iodophenyl)quinoxaline-2,3-diamine (PubChem CID 102985385) has the molecular formula C14H11IN4 and a molecular weight of 362.17 g/mol. Its IUPAC name is 3-N-(3-iodophenyl)quinoxaline-2,3-diamine.
| Compound Name | 3-N-(3-iodophenyl)quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 102985385 |
| Molecular Formula | C14H11IN4 |
| Molecular Weight | 362.17 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 3-N-(3-iodophenyl)quinoxaline-2,3-diamine |
| SMILES | Nc1nc2ccccc2nc1Nc1cccc(I)c1 |
| InChI | InChI=1S/C14H11IN4/c15-9-4-3-5-10(8-9)17-14-13(16)18-11-6-1-2-7-12(11)19-14/h1-8H,(H2,16,18)(H,17,19) |
| InChIKey | NIXSIQAJBTUOSL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.17 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|