C20H16N4O2S — CID 56663362
3-N-[3-(benzenesulfonyl)quinoxalin-2-yl]benzene-1,3-diamine (PubChem CID 56663362) has the molecular formula C20H16N4O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is 3-N-[3-(benzenesulfonyl)quinoxalin-2-yl]benzene-1,3-diamine.
| Compound Name | 3-N-[3-(benzenesulfonyl)quinoxalin-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 56663362 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 3-N-[3-(benzenesulfonyl)quinoxalin-2-yl]benzene-1,3-diamine |
| SMILES | Nc1cccc(Nc2nc3ccccc3nc2S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H16N4O2S/c21-14-7-6-8-15(13-14)22-19-20(24-18-12-5-4-11-17(18)23-19)27(25,26)16-9-2-1-3-10-16/h1-13H,21H2,(H,22,23) |
| InChIKey | ATEBSNHMECAWFP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|