C20H17BrN4S — CID 145495804
4-bromobenzenethiol;3-N-phenylquinoxaline-2,3-diamine (PubChem CID 145495804) has the molecular formula C20H17BrN4S and a molecular weight of 425.36 g/mol. Its IUPAC name is 4-bromobenzenethiol;3-N-phenylquinoxaline-2,3-diamine.
| Compound Name | 4-bromobenzenethiol;3-N-phenylquinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 145495804 |
| Molecular Formula | C20H17BrN4S |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 4-bromobenzenethiol;3-N-phenylquinoxaline-2,3-diamine |
| SMILES | Nc1nc2ccccc2nc1Nc1ccccc1.Sc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H12N4.C6H5BrS/c15-13-14(16-10-6-2-1-3-7-10)18-12-9-5-4-8-11(12)17-13;7-5-1-3-6(8)4-2-5/h1-9H,(H2,15,17)(H,16,18);1-4,8H |
| InChIKey | LSGSFFPNIKAUGB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|