C20H15BrN4OS — CID 143442942
4-[[3-[(4-bromophenyl)sulfanylamino]quinoxalin-2-yl]amino]phenol (PubChem CID 143442942) has the molecular formula C20H15BrN4OS and a molecular weight of 439.34 g/mol. Its IUPAC name is 4-[[3-[(4-bromophenyl)sulfanylamino]quinoxalin-2-yl]amino]phenol.
| Compound Name | 4-[[3-[(4-bromophenyl)sulfanylamino]quinoxalin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 143442942 |
| Molecular Formula | C20H15BrN4OS |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 4-[[3-[(4-bromophenyl)sulfanylamino]quinoxalin-2-yl]amino]phenol |
| SMILES | Oc1ccc(Nc2nc3ccccc3nc2NSc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H15BrN4OS/c21-13-5-11-16(12-6-13)27-25-20-19(22-14-7-9-15(26)10-8-14)23-17-3-1-2-4-18(17)24-20/h1-12,26H,(H,22,23)(H,24,25) |
| InChIKey | YYGLCTKPSUIGBR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|