C23H19N5O3S — CID 123481275
2-[[4-[[3-(phenylsulfanylamino)quinoxalin-2-yl]amino]benzoyl]amino]acetic acid (PubChem CID 123481275) has the molecular formula C23H19N5O3S and a molecular weight of 445.50 g/mol. Its IUPAC name is 2-[[4-[[3-(phenylsulfanylamino)quinoxalin-2-yl]amino]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[[3-(phenylsulfanylamino)quinoxalin-2-yl]amino]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 123481275 |
| Molecular Formula | C23H19N5O3S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-[[4-[[3-(phenylsulfanylamino)quinoxalin-2-yl]amino]benzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc(Nc2nc3ccccc3nc2NSc2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N5O3S/c29-20(30)14-24-23(31)15-10-12-16(13-11-15)25-21-22(28-32-17-6-2-1-3-7-17)27-19-9-5-4-8-18(19)26-21/h1-13H,14H2,(H,24,31)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | VOIPNOKUJYRGDL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 116.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|