C22H20N5O3S+ — CID 145495822
[3-[[3-(4-carboxy-3-hydroxyanilino)quinoxalin-2-yl]amino]sulfanylphenyl]-methylazanium (PubChem CID 145495822) has the molecular formula C22H20N5O3S+ and a molecular weight of 434.50 g/mol. Its IUPAC name is [3-[[3-(4-carboxy-3-hydroxyanilino)quinoxalin-2-yl]amino]sulfanylphenyl]-methylazanium.
| Compound Name | [3-[[3-(4-carboxy-3-hydroxyanilino)quinoxalin-2-yl]amino]sulfanylphenyl]-methylazanium |
|---|---|
| PubChem CID | 145495822 |
| Molecular Formula | C22H20N5O3S+ |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [3-[[3-(4-carboxy-3-hydroxyanilino)quinoxalin-2-yl]amino]sulfanylphenyl]-methylazanium |
| SMILES | C[NH2+]c1cccc(SNc2nc3ccccc3nc2Nc2ccc(C(=O)O)c(O)c2)c1 |
| InChI | InChI=1S/C22H19N5O3S/c1-23-13-5-4-6-15(11-13)31-27-21-20(25-17-7-2-3-8-18(17)26-21)24-14-9-10-16(22(29)30)19(28)12-14/h2-12,23,28H,1H3,(H,24,25)(H,26,27)(H,29,30)/p+1 |
| InChIKey | KUHHOERTSUITPW-UHFFFAOYSA-O |
| XLogP | 3.72 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|