C22H20N5O2S+ — CID 143442958
[3-[[3-(1,3-dihydro-2-benzofuran-5-ylamino)quinoxalin-2-yl]amino]sulfanylphenyl]-hydroxyazanium (PubChem CID 143442958) has the molecular formula C22H20N5O2S+ and a molecular weight of 418.50 g/mol. Its IUPAC name is [3-[[3-(1,3-dihydro-2-benzofuran-5-ylamino)quinoxalin-2-yl]amino]sulfanylphenyl]-hydroxyazanium.
| Compound Name | [3-[[3-(1,3-dihydro-2-benzofuran-5-ylamino)quinoxalin-2-yl]amino]sulfanylphenyl]-hydroxyazanium |
|---|---|
| PubChem CID | 143442958 |
| Molecular Formula | C22H20N5O2S+ |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [3-[[3-(1,3-dihydro-2-benzofuran-5-ylamino)quinoxalin-2-yl]amino]sulfanylphenyl]-hydroxyazanium |
| SMILES | O[NH2+]c1cccc(SNc2nc3ccccc3nc2Nc2ccc3c(c2)COC3)c1 |
| InChI | InChI=1S/C22H19N5O2S/c28-26-17-4-3-5-18(11-17)30-27-22-21(24-19-6-1-2-7-20(19)25-22)23-16-9-8-14-12-29-13-15(14)10-16/h1-11,26,28H,12-13H2,(H,23,24)(H,25,27)/p+1 |
| InChIKey | TZRSWAYNGKAEAN-UHFFFAOYSA-O |
| XLogP | 4.11 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|