About 3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine
3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine (PubChem CID 114262554) has the molecular formula C13H12ClN3O
and a molecular weight of 261.71 g/mol. Its IUPAC name is 3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine |
| PubChem CID | 114262554 |
| Molecular Formula | C13H12ClN3O |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine |
| SMILES | Nc1cnc(Nc2ccc3c(c2)COC3)c(Cl)c1 |
| InChI | InChI=1S/C13H12ClN3O/c14-12-4-10(15)5-16-13(12)17-11-2-1-8-6-18-7-9(8)3-11/h1-5H,6-7,15H2,(H,16,17) |
| InChIKey | CESLQYYWCWTUTD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine?
The IUPAC name of 3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine (CID 114262554) is 3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine.
What is the SMILES notation for 3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine?
The canonical SMILES for 3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine is Nc1cnc(Nc2ccc3c(c2)COC3)c(Cl)c1.
What is the InChIKey of 3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine?
The InChIKey is CESLQYYWCWTUTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN3O/c14-12-4-10(15)5-16-13(12)17-11-2-1-8-6-18-7-9(8)3-11/h1-5H,6-7,15H2,(H,16,17).
What are the key properties of 3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine?
3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine has a molecular weight of 261.71 g/mol, XLogP of 3.09, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-N-(1,3-dihydro-2-benzofuran-5-yl)pyridine-2,5-diamine is sourced from PubChem (CID 114262554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).