C12H12ClN3O — CID 82480714
3-chloro-2-N-(4-methoxyphenyl)pyridine-2,5-diamine (PubChem CID 82480714) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 3-chloro-2-N-(4-methoxyphenyl)pyridine-2,5-diamine.
| Compound Name | 3-chloro-2-N-(4-methoxyphenyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 82480714 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 3-chloro-2-N-(4-methoxyphenyl)pyridine-2,5-diamine |
| SMILES | COc1ccc(Nc2ncc(N)cc2Cl)cc1 |
| InChI | InChI=1S/C12H12ClN3O/c1-17-10-4-2-9(3-5-10)16-12-11(13)6-8(14)7-15-12/h2-7H,14H2,1H3,(H,15,16) |
| InChIKey | VICQQOIHMAVFOJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |