C24H27N5OS — CID 143628544
3-N-(3-aminophenyl)sulfanyl-2-N-(3-methoxy-5-methylphenyl)quinoxaline-2,3-diamine;ethane (PubChem CID 143628544) has the molecular formula C24H27N5OS and a molecular weight of 433.58 g/mol. Its IUPAC name is 3-N-(3-aminophenyl)sulfanyl-2-N-(3-methoxy-5-methylphenyl)quinoxaline-2,3-diamine;ethane.
| Compound Name | 3-N-(3-aminophenyl)sulfanyl-2-N-(3-methoxy-5-methylphenyl)quinoxaline-2,3-diamine;ethane |
|---|---|
| PubChem CID | 143628544 |
| Molecular Formula | C24H27N5OS |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 3-N-(3-aminophenyl)sulfanyl-2-N-(3-methoxy-5-methylphenyl)quinoxaline-2,3-diamine;ethane |
| SMILES | CC.COc1cc(C)cc(Nc2nc3ccccc3nc2NSc2cccc(N)c2)c1 |
| InChI | InChI=1S/C22H21N5OS.C2H6/c1-14-10-16(13-17(11-14)28-2)24-21-22(26-20-9-4-3-8-19(20)25-21)27-29-18-7-5-6-15(23)12-18;1-2/h3-13H,23H2,1-2H3,(H,24,25)(H,26,27);1-2H3 |
| InChIKey | PJCKGMBVDVJMMG-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|