C18H20N4O2 — CID 68879668
2-N-(3,5-dimethoxyphenyl)-3-N,3-N-dimethylquinoxaline-2,3-diamine (PubChem CID 68879668) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-N-(3,5-dimethoxyphenyl)-3-N,3-N-dimethylquinoxaline-2,3-diamine.
| Compound Name | 2-N-(3,5-dimethoxyphenyl)-3-N,3-N-dimethylquinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 68879668 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-N-(3,5-dimethoxyphenyl)-3-N,3-N-dimethylquinoxaline-2,3-diamine |
| SMILES | COc1cc(Nc2nc3ccccc3nc2N(C)C)cc(OC)c1 |
| InChI | InChI=1S/C18H20N4O2/c1-22(2)18-17(20-15-7-5-6-8-16(15)21-18)19-12-9-13(23-3)11-14(10-12)24-4/h5-11H,1-4H3,(H,19,20) |
| InChIKey | KOWBDFNPGHSHJF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |