C30H26N5O5S- — CID 175266289
2-(3,5-dimethoxyanilino)-3-[3-[(2-methylbenzoyl)amino]-N-sulfinatoanilino]quinoxaline (PubChem CID 175266289) has the molecular formula C30H26N5O5S- and a molecular weight of 568.64 g/mol. Its IUPAC name is 2-(3,5-dimethoxyanilino)-3-[3-[(2-methylbenzoyl)amino]-N-sulfinatoanilino]quinoxaline.
| Compound Name | 2-(3,5-dimethoxyanilino)-3-[3-[(2-methylbenzoyl)amino]-N-sulfinatoanilino]quinoxaline |
|---|---|
| PubChem CID | 175266289 |
| Molecular Formula | C30H26N5O5S- |
| Molecular Weight | 568.64 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | 2-(3,5-dimethoxyanilino)-3-[3-[(2-methylbenzoyl)amino]-N-sulfinatoanilino]quinoxaline |
| SMILES | COc1cc(Nc2nc3ccccc3nc2N(c2cccc(NC(=O)c3ccccc3C)c2)S(=O)[O-])cc(OC)c1 |
| InChI | InChI=1S/C30H27N5O5S/c1-19-9-4-5-12-25(19)30(36)32-20-10-8-11-22(15-20)35(41(37)38)29-28(33-26-13-6-7-14-27(26)34-29)31-21-16-23(39-2)18-24(17-21)40-3/h4-18H,1-3H3,(H,31,33)(H,32,36)(H,37,38)/p-1 |
| InChIKey | XGMXAMCUEUOANF-UHFFFAOYSA-M |
| XLogP | 5.88 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|