C30H25FN5O5S- — CID 174624192
2-(3,5-dimethoxyanilino)-3-[3-[(5-fluoro-2-methylbenzoyl)amino]-N-sulfinatoanilino]quinoxaline (PubChem CID 174624192) has the molecular formula C30H25FN5O5S- and a molecular weight of 586.63 g/mol. Its IUPAC name is 2-(3,5-dimethoxyanilino)-3-[3-[(5-fluoro-2-methylbenzoyl)amino]-N-sulfinatoanilino]quinoxaline.
| Compound Name | 2-(3,5-dimethoxyanilino)-3-[3-[(5-fluoro-2-methylbenzoyl)amino]-N-sulfinatoanilino]quinoxaline |
|---|---|
| PubChem CID | 174624192 |
| Molecular Formula | C30H25FN5O5S- |
| Molecular Weight | 586.63 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | 2-(3,5-dimethoxyanilino)-3-[3-[(5-fluoro-2-methylbenzoyl)amino]-N-sulfinatoanilino]quinoxaline |
| SMILES | COc1cc(Nc2nc3ccccc3nc2N(c2cccc(NC(=O)c3cc(F)ccc3C)c2)S(=O)[O-])cc(OC)c1 |
| InChI | InChI=1S/C30H26FN5O5S/c1-18-11-12-19(31)13-25(18)30(37)33-20-7-6-8-22(14-20)36(42(38)39)29-28(34-26-9-4-5-10-27(26)35-29)32-21-15-23(40-2)17-24(16-21)41-3/h4-17H,1-3H3,(H,32,34)(H,33,37)(H,38,39)/p-1 |
| InChIKey | AXHTUGYBOXOEBI-UHFFFAOYSA-M |
| XLogP | 6.02 |
| TPSA | 128.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|