C29H29N5O6S — CID 175375131
2-[3-[(4-cyclopropyl-4-oxobutanoyl)amino]-N-sulfinoanilino]-3-(3,5-dimethoxyanilino)quinoxaline (PubChem CID 175375131) has the molecular formula C29H29N5O6S and a molecular weight of 575.65 g/mol. Its IUPAC name is 2-[3-[(4-cyclopropyl-4-oxobutanoyl)amino]-N-sulfinoanilino]-3-(3,5-dimethoxyanilino)quinoxaline.
| Compound Name | 2-[3-[(4-cyclopropyl-4-oxobutanoyl)amino]-N-sulfinoanilino]-3-(3,5-dimethoxyanilino)quinoxaline |
|---|---|
| PubChem CID | 175375131 |
| Molecular Formula | C29H29N5O6S |
| Molecular Weight | 575.65 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | 2-[3-[(4-cyclopropyl-4-oxobutanoyl)amino]-N-sulfinoanilino]-3-(3,5-dimethoxyanilino)quinoxaline |
| SMILES | COc1cc(Nc2nc3ccccc3nc2N(c2cccc(NC(=O)CCC(=O)C3CC3)c2)S(=O)O)cc(OC)c1 |
| InChI | InChI=1S/C29H29N5O6S/c1-39-22-15-20(16-23(17-22)40-2)31-28-29(33-25-9-4-3-8-24(25)32-28)34(41(37)38)21-7-5-6-19(14-21)30-27(36)13-12-26(35)18-10-11-18/h3-9,14-18H,10-13H2,1-2H3,(H,30,36)(H,31,32)(H,37,38) |
| InChIKey | PKGKCNTZVCIJRP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 142.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.65 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|