C27H27ClN6O4S — CID 174679089
2-[3-[carbamoyl(cyclopentyl)amino]-N-sulfinoanilino]-3-(2-chloro-5-methoxyanilino)quinoxaline (PubChem CID 174679089) has the molecular formula C27H27ClN6O4S and a molecular weight of 567.07 g/mol. Its IUPAC name is 2-[3-[carbamoyl(cyclopentyl)amino]-N-sulfinoanilino]-3-(2-chloro-5-methoxyanilino)quinoxaline.
| Compound Name | 2-[3-[carbamoyl(cyclopentyl)amino]-N-sulfinoanilino]-3-(2-chloro-5-methoxyanilino)quinoxaline |
|---|---|
| PubChem CID | 174679089 |
| Molecular Formula | C27H27ClN6O4S |
| Molecular Weight | 567.07 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | 2-[3-[carbamoyl(cyclopentyl)amino]-N-sulfinoanilino]-3-(2-chloro-5-methoxyanilino)quinoxaline |
| SMILES | COc1ccc(Cl)c(Nc2nc3ccccc3nc2N(c2cccc(N(C(N)=O)C3CCCC3)c2)S(=O)O)c1 |
| InChI | InChI=1S/C27H27ClN6O4S/c1-38-20-13-14-21(28)24(16-20)31-25-26(32-23-12-5-4-11-22(23)30-25)34(39(36)37)19-10-6-9-18(15-19)33(27(29)35)17-7-2-3-8-17/h4-6,9-17H,2-3,7-8H2,1H3,(H2,29,35)(H,30,31)(H,36,37) |
| InChIKey | FWYIJXDEDZKSTE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.07 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|