C26H25ClN6O4S — CID 175277644
2-[3-[(2R)-2-carbamoylpyrrolidin-1-yl]-N-sulfinoanilino]-3-(2-chloro-5-methoxyanilino)quinoxaline (PubChem CID 175277644) has the molecular formula C26H25ClN6O4S and a molecular weight of 553.04 g/mol. Its IUPAC name is 2-[3-[(2R)-2-carbamoylpyrrolidin-1-yl]-N-sulfinoanilino]-3-(2-chloro-5-methoxyanilino)quinoxaline.
| Compound Name | 2-[3-[(2R)-2-carbamoylpyrrolidin-1-yl]-N-sulfinoanilino]-3-(2-chloro-5-methoxyanilino)quinoxaline |
|---|---|
| PubChem CID | 175277644 |
| Molecular Formula | C26H25ClN6O4S |
| Molecular Weight | 553.04 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 2-[3-[(2R)-2-carbamoylpyrrolidin-1-yl]-N-sulfinoanilino]-3-(2-chloro-5-methoxyanilino)quinoxaline |
| SMILES | COc1ccc(Cl)c(Nc2nc3ccccc3nc2N(c2cccc(N3CCC[C@@H]3C(N)=O)c2)S(=O)O)c1 |
| InChI | InChI=1S/C26H25ClN6O4S/c1-37-18-11-12-19(27)22(15-18)30-25-26(31-21-9-3-2-8-20(21)29-25)33(38(35)36)17-7-4-6-16(14-17)32-13-5-10-23(32)24(28)34/h2-4,6-9,11-12,14-15,23H,5,10,13H2,1H3,(H2,28,34)(H,29,30)(H,35,36)/t23-/m1/s1 |
| InChIKey | OBHXWTKDPKZIDZ-HSZRJFAPSA-N |
| XLogP | 4.76 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.04 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|