C28H21ClN8O4S — CID 174691244
2-(2-chloro-5-methoxyanilino)-3-[3-(pyridin-3-ylmethyliminoazaniumylidenecarbamoyl)-N-sulfinatoanilino]quinoxaline (PubChem CID 174691244) has the molecular formula C28H21ClN8O4S and a molecular weight of 601.05 g/mol. Its IUPAC name is 2-(2-chloro-5-methoxyanilino)-3-[3-(pyridin-3-ylmethyliminoazaniumylidenecarbamoyl)-N-sulfinatoanilino]quinoxaline.
| Compound Name | 2-(2-chloro-5-methoxyanilino)-3-[3-(pyridin-3-ylmethyliminoazaniumylidenecarbamoyl)-N-sulfinatoanilino]quinoxaline |
|---|---|
| PubChem CID | 174691244 |
| Molecular Formula | C28H21ClN8O4S |
| Molecular Weight | 601.05 g/mol |
| Exact Mass | 600.11 |
| IUPAC Name | 2-(2-chloro-5-methoxyanilino)-3-[3-(pyridin-3-ylmethyliminoazaniumylidenecarbamoyl)-N-sulfinatoanilino]quinoxaline |
| SMILES | COc1ccc(Cl)c(Nc2nc3ccccc3nc2N(c2cccc(C(=O)N=[N+]=NCc3cccnc3)c2)S(=O)[O-])c1 |
| InChI | InChI=1S/C28H21ClN8O4S/c1-41-21-11-12-22(29)25(15-21)33-26-27(34-24-10-3-2-9-23(24)32-26)37(42(39)40)20-8-4-7-19(14-20)28(38)35-36-31-17-18-6-5-13-30-16-18/h2-16H,17H2,1H3,(H-,32,33,39,40) |
| InChIKey | DZMOWELZTQJEJE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 159.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.05 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|