C29H31N6O5S- — CID 175269076
2-(3,5-dimethoxyanilino)-3-[3-[[2-(2-methylpyrrolidin-1-yl)acetyl]amino]-N-sulfinatoanilino]quinoxaline (PubChem CID 175269076) has the molecular formula C29H31N6O5S- and a molecular weight of 575.67 g/mol. Its IUPAC name is 2-(3,5-dimethoxyanilino)-3-[3-[[2-(2-methylpyrrolidin-1-yl)acetyl]amino]-N-sulfinatoanilino]quinoxaline.
| Compound Name | 2-(3,5-dimethoxyanilino)-3-[3-[[2-(2-methylpyrrolidin-1-yl)acetyl]amino]-N-sulfinatoanilino]quinoxaline |
|---|---|
| PubChem CID | 175269076 |
| Molecular Formula | C29H31N6O5S- |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 2-(3,5-dimethoxyanilino)-3-[3-[[2-(2-methylpyrrolidin-1-yl)acetyl]amino]-N-sulfinatoanilino]quinoxaline |
| SMILES | COc1cc(Nc2nc3ccccc3nc2N(c2cccc(NC(=O)CN3CCCC3C)c2)S(=O)[O-])cc(OC)c1 |
| InChI | InChI=1S/C29H32N6O5S/c1-19-8-7-13-34(19)18-27(36)30-20-9-6-10-22(14-20)35(41(37)38)29-28(32-25-11-4-5-12-26(25)33-29)31-21-15-23(39-2)17-24(16-21)40-3/h4-6,9-12,14-17,19H,7-8,13,18H2,1-3H3,(H,30,36)(H,31,32)(H,37,38)/p-1 |
| InChIKey | CLWFFOMUAYZSGU-UHFFFAOYSA-M |
| XLogP | 4.75 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|