C30H29N7O5S — CID 174624344
2-(3,5-dimethoxyanilino)-3-[3-[[2-(pyridin-2-ylmethylamino)acetyl]amino]-N-sulfinoanilino]quinoxaline (PubChem CID 174624344) has the molecular formula C30H29N7O5S and a molecular weight of 599.67 g/mol. Its IUPAC name is 2-(3,5-dimethoxyanilino)-3-[3-[[2-(pyridin-2-ylmethylamino)acetyl]amino]-N-sulfinoanilino]quinoxaline.
| Compound Name | 2-(3,5-dimethoxyanilino)-3-[3-[[2-(pyridin-2-ylmethylamino)acetyl]amino]-N-sulfinoanilino]quinoxaline |
|---|---|
| PubChem CID | 174624344 |
| Molecular Formula | C30H29N7O5S |
| Molecular Weight | 599.67 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | 2-(3,5-dimethoxyanilino)-3-[3-[[2-(pyridin-2-ylmethylamino)acetyl]amino]-N-sulfinoanilino]quinoxaline |
| SMILES | COc1cc(Nc2nc3ccccc3nc2N(c2cccc(NC(=O)CNCc3ccccn3)c2)S(=O)O)cc(OC)c1 |
| InChI | InChI=1S/C30H29N7O5S/c1-41-24-15-22(16-25(17-24)42-2)34-29-30(36-27-12-4-3-11-26(27)35-29)37(43(39)40)23-10-7-9-20(14-23)33-28(38)19-31-18-21-8-5-6-13-32-21/h3-17,31H,18-19H2,1-2H3,(H,33,38)(H,34,35)(H,39,40) |
| InChIKey | DPCOSGUTSQGDGN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 150.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|