C29H24FN5O5S — CID 175266326
2-(3,5-dimethoxyanilino)-3-[3-[(3-fluorobenzoyl)amino]-N-sulfinoanilino]quinoxaline (PubChem CID 175266326) has the molecular formula C29H24FN5O5S and a molecular weight of 573.61 g/mol. Its IUPAC name is 2-(3,5-dimethoxyanilino)-3-[3-[(3-fluorobenzoyl)amino]-N-sulfinoanilino]quinoxaline.
| Compound Name | 2-(3,5-dimethoxyanilino)-3-[3-[(3-fluorobenzoyl)amino]-N-sulfinoanilino]quinoxaline |
|---|---|
| PubChem CID | 175266326 |
| Molecular Formula | C29H24FN5O5S |
| Molecular Weight | 573.61 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | 2-(3,5-dimethoxyanilino)-3-[3-[(3-fluorobenzoyl)amino]-N-sulfinoanilino]quinoxaline |
| SMILES | COc1cc(Nc2nc3ccccc3nc2N(c2cccc(NC(=O)c3cccc(F)c3)c2)S(=O)O)cc(OC)c1 |
| InChI | InChI=1S/C29H24FN5O5S/c1-39-23-15-21(16-24(17-23)40-2)31-27-28(34-26-12-4-3-11-25(26)33-27)35(41(37)38)22-10-6-9-20(14-22)32-29(36)18-7-5-8-19(30)13-18/h3-17H,1-2H3,(H,31,33)(H,32,36)(H,37,38) |
| InChIKey | MGRPZTOVZFPESO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 125.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.61 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|