C29H22ClN7O5S — CID 175375132
2-[3-[(3-chlorobenzoyl)iminoazaniumylideneamino]-N-sulfinatoanilino]-3-(3,5-dimethoxyanilino)quinoxaline (PubChem CID 175375132) has the molecular formula C29H22ClN7O5S and a molecular weight of 616.06 g/mol. Its IUPAC name is 2-[3-[(3-chlorobenzoyl)iminoazaniumylideneamino]-N-sulfinatoanilino]-3-(3,5-dimethoxyanilino)quinoxaline.
| Compound Name | 2-[3-[(3-chlorobenzoyl)iminoazaniumylideneamino]-N-sulfinatoanilino]-3-(3,5-dimethoxyanilino)quinoxaline |
|---|---|
| PubChem CID | 175375132 |
| Molecular Formula | C29H22ClN7O5S |
| Molecular Weight | 616.06 g/mol |
| Exact Mass | 615.11 |
| IUPAC Name | 2-[3-[(3-chlorobenzoyl)iminoazaniumylideneamino]-N-sulfinatoanilino]-3-(3,5-dimethoxyanilino)quinoxaline |
| SMILES | COc1cc(Nc2nc3ccccc3nc2N(c2cccc(N=[N+]=NC(=O)c3cccc(Cl)c3)c2)S(=O)[O-])cc(OC)c1 |
| InChI | InChI=1S/C29H22ClN7O5S/c1-41-23-15-21(16-24(17-23)42-2)31-27-28(33-26-12-4-3-11-25(26)32-27)37(43(39)40)22-10-6-9-20(14-22)34-36-35-29(38)18-7-5-8-19(30)13-18/h3-17H,1-2H3,(H-,31,32,39,40) |
| InChIKey | SKDJPDVHWDSUMR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 155.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.06 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|