C24H23ClN6O4S — CID 57448635
N-[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]-3-(dimethylaminocarbamoyl)benzenesulfonamide (PubChem CID 57448635) has the molecular formula C24H23ClN6O4S and a molecular weight of 527.01 g/mol. Its IUPAC name is N-[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]-3-(dimethylaminocarbamoyl)benzenesulfonamide.
| Compound Name | N-[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]-3-(dimethylaminocarbamoyl)benzenesulfonamide |
|---|---|
| PubChem CID | 57448635 |
| Molecular Formula | C24H23ClN6O4S |
| Molecular Weight | 527.01 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | N-[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]-3-(dimethylaminocarbamoyl)benzenesulfonamide |
| SMILES | COc1ccc(Cl)c(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccc(C(=O)NN(C)C)c2)c1 |
| InChI | InChI=1S/C24H23ClN6O4S/c1-31(2)29-24(32)15-7-6-8-17(13-15)36(33,34)30-23-22(26-19-9-4-5-10-20(19)27-23)28-21-14-16(35-3)11-12-18(21)25/h4-14H,1-3H3,(H,26,28)(H,27,30)(H,29,32) |
| InChIKey | AACMBRMCMONCMB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.01 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|