C25H24ClFN6O4S — CID 59249132
N-[3-[[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]-2-(2-fluoroethylamino)acetamide (PubChem CID 59249132) has the molecular formula C25H24ClFN6O4S and a molecular weight of 559.02 g/mol. Its IUPAC name is N-[3-[[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]-2-(2-fluoroethylamino)acetamide.
| Compound Name | N-[3-[[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]-2-(2-fluoroethylamino)acetamide |
|---|---|
| PubChem CID | 59249132 |
| Molecular Formula | C25H24ClFN6O4S |
| Molecular Weight | 559.02 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | N-[3-[[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]-2-(2-fluoroethylamino)acetamide |
| SMILES | COc1ccc(Cl)c(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccc(NC(=O)CNCCF)c2)c1 |
| InChI | InChI=1S/C25H24ClFN6O4S/c1-37-17-9-10-19(26)22(14-17)32-24-25(31-21-8-3-2-7-20(21)30-24)33-38(35,36)18-6-4-5-16(13-18)29-23(34)15-28-12-11-27/h2-10,13-14,28H,11-12,15H2,1H3,(H,29,34)(H,30,32)(H,31,33) |
| InChIKey | JWHXRVWXHZSVFW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 134.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.02 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|