C29H33N7O5S — CID 143443028
N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]-2-[2-(prop-2-enylamino)ethylamino]acetamide (PubChem CID 143443028) has the molecular formula C29H33N7O5S and a molecular weight of 591.69 g/mol. Its IUPAC name is N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]-2-[2-(prop-2-enylamino)ethylamino]acetamide.
| Compound Name | N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]-2-[2-(prop-2-enylamino)ethylamino]acetamide |
|---|---|
| PubChem CID | 143443028 |
| Molecular Formula | C29H33N7O5S |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]-2-[2-(prop-2-enylamino)ethylamino]acetamide |
| SMILES | C=CCNCCNCC(=O)Nc1cccc(S(=O)(=O)Nc2nc3ccccc3nc2Nc2cc(OC)cc(OC)c2)c1 |
| InChI | InChI=1S/C29H33N7O5S/c1-4-12-30-13-14-31-19-27(37)32-20-8-7-9-24(17-20)42(38,39)36-29-28(34-25-10-5-6-11-26(25)35-29)33-21-15-22(40-2)18-23(16-21)41-3/h4-11,15-18,30-31H,1,12-14,19H2,2-3H3,(H,32,37)(H,33,34)(H,35,36) |
| InChIKey | YMBCJLVBHHUFLU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 155.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|