C28H34N6O5S — CID 162126396
2-(butylamino)-N-[3-[[3-(3-hydroxy-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide;methane (PubChem CID 162126396) has the molecular formula C28H34N6O5S and a molecular weight of 566.68 g/mol. Its IUPAC name is 2-(butylamino)-N-[3-[[3-(3-hydroxy-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide;methane.
| Compound Name | 2-(butylamino)-N-[3-[[3-(3-hydroxy-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide;methane |
|---|---|
| PubChem CID | 162126396 |
| Molecular Formula | C28H34N6O5S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 2-(butylamino)-N-[3-[[3-(3-hydroxy-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide;methane |
| SMILES | C.CCCCNCC(=O)Nc1cccc(S(=O)(=O)Nc2nc3ccccc3nc2Nc2cc(O)cc(OC)c2)c1 |
| InChI | InChI=1S/C27H30N6O5S.CH4/c1-3-4-12-28-17-25(35)29-18-8-7-9-22(15-18)39(36,37)33-27-26(31-23-10-5-6-11-24(23)32-27)30-19-13-20(34)16-21(14-19)38-2;/h5-11,13-16,28,34H,3-4,12,17H2,1-2H3,(H,29,35)(H,30,31)(H,32,33);1H4 |
| InChIKey | ZIBWFWWVFSLPSN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 154.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|