C31H30N6O6S — CID 59249129
N-[3-[[3-(3-hydroxy-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]-2-[(4-methylphenyl)methoxyamino]acetamide (PubChem CID 59249129) has the molecular formula C31H30N6O6S and a molecular weight of 614.68 g/mol. Its IUPAC name is N-[3-[[3-(3-hydroxy-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]-2-[(4-methylphenyl)methoxyamino]acetamide.
| Compound Name | N-[3-[[3-(3-hydroxy-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]-2-[(4-methylphenyl)methoxyamino]acetamide |
|---|---|
| PubChem CID | 59249129 |
| Molecular Formula | C31H30N6O6S |
| Molecular Weight | 614.68 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | N-[3-[[3-(3-hydroxy-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]-2-[(4-methylphenyl)methoxyamino]acetamide |
| SMILES | COc1cc(O)cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccc(NC(=O)CNOCc3ccc(C)cc3)c2)c1 |
| InChI | InChI=1S/C31H30N6O6S/c1-20-10-12-21(13-11-20)19-43-32-18-29(39)33-22-6-5-7-26(16-22)44(40,41)37-31-30(35-27-8-3-4-9-28(27)36-31)34-23-14-24(38)17-25(15-23)42-2/h3-17,32,38H,18-19H2,1-2H3,(H,33,39)(H,34,35)(H,36,37) |
| InChIKey | WQGZEDRKQLUBPE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 163.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|