C24H22BrN5O5S — CID 59249165
2-bromo-N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide (PubChem CID 59249165) has the molecular formula C24H22BrN5O5S and a molecular weight of 572.44 g/mol. Its IUPAC name is 2-bromo-N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | 2-bromo-N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 59249165 |
| Molecular Formula | C24H22BrN5O5S |
| Molecular Weight | 572.44 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | 2-bromo-N-[3-[[3-(3,5-dimethoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccc(NC(=O)CBr)c2)cc(OC)c1 |
| InChI | InChI=1S/C24H22BrN5O5S/c1-34-17-10-16(11-18(13-17)35-2)27-23-24(29-21-9-4-3-8-20(21)28-23)30-36(32,33)19-7-5-6-15(12-19)26-22(31)14-25/h3-13H,14H2,1-2H3,(H,26,31)(H,27,28)(H,29,30) |
| InChIKey | IDGCWUXVNMIIMO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|