C28H29N7O6S — CID 59249191
2-(4-formylpiperazin-1-yl)-N-[3-[[3-(3-hydroxy-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide (PubChem CID 59249191) has the molecular formula C28H29N7O6S and a molecular weight of 591.65 g/mol. Its IUPAC name is 2-(4-formylpiperazin-1-yl)-N-[3-[[3-(3-hydroxy-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(4-formylpiperazin-1-yl)-N-[3-[[3-(3-hydroxy-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 59249191 |
| Molecular Formula | C28H29N7O6S |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | 2-(4-formylpiperazin-1-yl)-N-[3-[[3-(3-hydroxy-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide |
| SMILES | COc1cc(O)cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccc(NC(=O)CN3CCN(C=O)CC3)c2)c1 |
| InChI | InChI=1S/C28H29N7O6S/c1-41-22-14-20(13-21(37)16-22)30-27-28(32-25-8-3-2-7-24(25)31-27)33-42(39,40)23-6-4-5-19(15-23)29-26(38)17-34-9-11-35(18-36)12-10-34/h2-8,13-16,18,37H,9-12,17H2,1H3,(H,29,38)(H,30,31)(H,32,33) |
| InChIKey | LFRKVWDJHVDNLS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 166.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|