C29H31ClN6O4S — CID 57448629
3-[[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide (PubChem CID 57448629) has the molecular formula C29H31ClN6O4S and a molecular weight of 595.13 g/mol. Its IUPAC name is 3-[[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide.
| Compound Name | 3-[[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 57448629 |
| Molecular Formula | C29H31ClN6O4S |
| Molecular Weight | 595.13 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | 3-[[3-(2-chloro-5-methoxyanilino)quinoxalin-2-yl]sulfamoyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide |
| SMILES | COc1ccc(Cl)c(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccc(C(=O)NCCCN3CCCC3)c2)c1 |
| InChI | InChI=1S/C29H31ClN6O4S/c1-40-21-12-13-23(30)26(19-21)34-27-28(33-25-11-3-2-10-24(25)32-27)35-41(38,39)22-9-6-8-20(18-22)29(37)31-14-7-17-36-15-4-5-16-36/h2-3,6,8-13,18-19H,4-5,7,14-17H2,1H3,(H,31,37)(H,32,34)(H,33,35) |
| InChIKey | LDRYDBSUULYUAY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.13 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|