C26H26ClFN6O4S — CID 174691319
2-(2-chloro-5-methoxyanilino)-3-[3-[2-(dimethylamino)ethylcarbamoyl]-4-fluoro-N-sulfinoanilino]quinoxaline (PubChem CID 174691319) has the molecular formula C26H26ClFN6O4S and a molecular weight of 573.05 g/mol. Its IUPAC name is 2-(2-chloro-5-methoxyanilino)-3-[3-[2-(dimethylamino)ethylcarbamoyl]-4-fluoro-N-sulfinoanilino]quinoxaline.
| Compound Name | 2-(2-chloro-5-methoxyanilino)-3-[3-[2-(dimethylamino)ethylcarbamoyl]-4-fluoro-N-sulfinoanilino]quinoxaline |
|---|---|
| PubChem CID | 174691319 |
| Molecular Formula | C26H26ClFN6O4S |
| Molecular Weight | 573.05 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 2-(2-chloro-5-methoxyanilino)-3-[3-[2-(dimethylamino)ethylcarbamoyl]-4-fluoro-N-sulfinoanilino]quinoxaline |
| SMILES | COc1ccc(Cl)c(Nc2nc3ccccc3nc2N(c2ccc(F)c(C(=O)NCCN(C)C)c2)S(=O)O)c1 |
| InChI | InChI=1S/C26H26ClFN6O4S/c1-33(2)13-12-29-26(35)18-14-16(8-11-20(18)28)34(39(36)37)25-24(30-21-6-4-5-7-22(21)32-25)31-23-15-17(38-3)9-10-19(23)27/h4-11,14-15H,12-13H2,1-3H3,(H,29,35)(H,30,31)(H,36,37) |
| InChIKey | PXOFDMQOUPYHLB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.05 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|