C23H23N5O3 — CID 145134762
2-N-(3,5-dimethoxyphenyl)-3-N-[4-(methylamino)phenoxy]quinoxaline-2,3-diamine (PubChem CID 145134762) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-N-(3,5-dimethoxyphenyl)-3-N-[4-(methylamino)phenoxy]quinoxaline-2,3-diamine.
| Compound Name | 2-N-(3,5-dimethoxyphenyl)-3-N-[4-(methylamino)phenoxy]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 145134762 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-N-(3,5-dimethoxyphenyl)-3-N-[4-(methylamino)phenoxy]quinoxaline-2,3-diamine |
| SMILES | CNc1ccc(ONc2nc3ccccc3nc2Nc2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C23H23N5O3/c1-24-15-8-10-17(11-9-15)31-28-23-22(26-20-6-4-5-7-21(20)27-23)25-16-12-18(29-2)14-19(13-16)30-3/h4-14,24H,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | NTTGYEUQTYGMTA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 89.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|