C27H29N5O3S — CID 145495783
N-(2-butoxy-2-hydroxyethyl)-4-[[3-(phenylsulfanylamino)quinoxalin-2-yl]amino]benzamide (PubChem CID 145495783) has the molecular formula C27H29N5O3S and a molecular weight of 503.63 g/mol. Its IUPAC name is N-(2-butoxy-2-hydroxyethyl)-4-[[3-(phenylsulfanylamino)quinoxalin-2-yl]amino]benzamide.
| Compound Name | N-(2-butoxy-2-hydroxyethyl)-4-[[3-(phenylsulfanylamino)quinoxalin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 145495783 |
| Molecular Formula | C27H29N5O3S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | N-(2-butoxy-2-hydroxyethyl)-4-[[3-(phenylsulfanylamino)quinoxalin-2-yl]amino]benzamide |
| SMILES | CCCCOC(O)CNC(=O)c1ccc(Nc2nc3ccccc3nc2NSc2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N5O3S/c1-2-3-17-35-24(33)18-28-27(34)19-13-15-20(16-14-19)29-25-26(32-36-21-9-5-4-6-10-21)31-23-12-8-7-11-22(23)30-25/h4-16,24,33H,2-3,17-18H2,1H3,(H,28,34)(H,29,30)(H,31,32) |
| InChIKey | JEUYIZWSNXHLSB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|