C23H31NO2S — CID 133239632
N-(2-ethylhexyl)-4-(2-phenylsulfanylethoxy)benzamide (PubChem CID 133239632) has the molecular formula C23H31NO2S and a molecular weight of 385.57 g/mol. Its IUPAC name is N-(2-ethylhexyl)-4-(2-phenylsulfanylethoxy)benzamide.
| Compound Name | N-(2-ethylhexyl)-4-(2-phenylsulfanylethoxy)benzamide |
|---|---|
| PubChem CID | 133239632 |
| Molecular Formula | C23H31NO2S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | N-(2-ethylhexyl)-4-(2-phenylsulfanylethoxy)benzamide |
| SMILES | CCCCC(CC)CNC(=O)c1ccc(OCCSc2ccccc2)cc1 |
| InChI | InChI=1S/C23H31NO2S/c1-3-5-9-19(4-2)18-24-23(25)20-12-14-21(15-13-20)26-16-17-27-22-10-7-6-8-11-22/h6-8,10-15,19H,3-5,9,16-18H2,1-2H3,(H,24,25) |
| InChIKey | JHRAPSNYSZDAJX-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|