C19H31NO — CID 91723782
4-butyl-N-(2-ethylhexyl)benzamide (PubChem CID 91723782) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 4-butyl-N-(2-ethylhexyl)benzamide.
| Compound Name | 4-butyl-N-(2-ethylhexyl)benzamide |
|---|---|
| PubChem CID | 91723782 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 4-butyl-N-(2-ethylhexyl)benzamide |
| SMILES | CCCCc1ccc(C(=O)NCC(CC)CCCC)cc1 |
| InChI | InChI=1S/C19H31NO/c1-4-7-9-16(6-3)15-20-19(21)18-13-11-17(12-14-18)10-8-5-2/h11-14,16H,4-10,15H2,1-3H3,(H,20,21) |
| InChIKey | IAVZWWHYHSTCCU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |