C14H22N2O — CID 2165504
N-[(2S)-2-ethylhexyl]pyridine-3-carboxamide (PubChem CID 2165504) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N-[(2S)-2-ethylhexyl]pyridine-3-carboxamide.
| Compound Name | N-[(2S)-2-ethylhexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2165504 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N-[(2S)-2-ethylhexyl]pyridine-3-carboxamide |
| SMILES | CCCC[C@H](CC)CNC(=O)c1cccnc1 |
| InChI | InChI=1S/C14H22N2O/c1-3-5-7-12(4-2)10-16-14(17)13-8-6-9-15-11-13/h6,8-9,11-12H,3-5,7,10H2,1-2H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | LAMZDBBLBQNWLV-LBPRGKRZSA-N |
| XLogP | 3.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |