C23H39N3O2 — CID 5210058
2-N,6-N-bis(2-ethylhexyl)pyridine-2,6-dicarboxamide (PubChem CID 5210058) has the molecular formula C23H39N3O2 and a molecular weight of 389.58 g/mol. Its IUPAC name is 2-N,6-N-bis(2-ethylhexyl)pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis(2-ethylhexyl)pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 5210058 |
| Molecular Formula | C23H39N3O2 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | 2-N,6-N-bis(2-ethylhexyl)pyridine-2,6-dicarboxamide |
| SMILES | CCCCC(CC)CNC(=O)c1cccc(C(=O)NCC(CC)CCCC)n1 |
| InChI | InChI=1S/C23H39N3O2/c1-5-9-12-18(7-3)16-24-22(27)20-14-11-15-21(26-20)23(28)25-17-19(8-4)13-10-6-2/h11,14-15,18-19H,5-10,12-13,16-17H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | SBAKTRPHOZTSJA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |