C20H27NO — CID 7314092
N-[(2R)-2-ethylhexyl]-2-naphthalen-1-ylacetamide (PubChem CID 7314092) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is N-[(2R)-2-ethylhexyl]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(2R)-2-ethylhexyl]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 7314092 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-[(2R)-2-ethylhexyl]-2-naphthalen-1-ylacetamide |
| SMILES | CCCC[C@@H](CC)CNC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C20H27NO/c1-3-5-9-16(4-2)15-21-20(22)14-18-12-8-11-17-10-6-7-13-19(17)18/h6-8,10-13,16H,3-5,9,14-15H2,1-2H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | DLGUYVHATYFABS-MRXNPFEDSA-N |
| XLogP | 4.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |