C16H19NO3 — CID 60653057
N-(2,2-dimethoxyethyl)-2-naphthalen-1-ylacetamide (PubChem CID 60653057) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-naphthalen-1-ylacetamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 60653057 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-naphthalen-1-ylacetamide |
| SMILES | COC(CNC(=O)Cc1cccc2ccccc12)OC |
| InChI | InChI=1S/C16H19NO3/c1-19-16(20-2)11-17-15(18)10-13-8-5-7-12-6-3-4-9-14(12)13/h3-9,16H,10-11H2,1-2H3,(H,17,18) |
| InChIKey | RPHKMSYUPRQSBX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|