C15H23BClNO3 — CID 99738113
[2-chloro-5-[[(2R)-2-ethylhexyl]carbamoyl]phenyl]boronic acid (PubChem CID 99738113) has the molecular formula C15H23BClNO3 and a molecular weight of 311.62 g/mol. Its IUPAC name is [2-chloro-5-[[(2R)-2-ethylhexyl]carbamoyl]phenyl]boronic acid.
| Compound Name | [2-chloro-5-[[(2R)-2-ethylhexyl]carbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 99738113 |
| Molecular Formula | C15H23BClNO3 |
| Molecular Weight | 311.62 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | [2-chloro-5-[[(2R)-2-ethylhexyl]carbamoyl]phenyl]boronic acid |
| SMILES | CCCC[C@@H](CC)CNC(=O)c1ccc(Cl)c(B(O)O)c1 |
| InChI | InChI=1S/C15H23BClNO3/c1-3-5-6-11(4-2)10-18-15(19)12-7-8-14(17)13(9-12)16(20)21/h7-9,11,20-21H,3-6,10H2,1-2H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | KZKJOHJZXYNIFD-LLVKDONJSA-N |
| XLogP | 1.97 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.62 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|